Polyfunctional Compounds

Polyfunctional Compounds

Updated Apr 10, 2026

Every section up to this point has taught you one piece of the naming puzzle. Now it is time to assemble the full picture. Real MCAT molecules - amino acids, drugs, metabolic intermediates - are not simple one-functional-group compounds. They have two, three, or even four functional groups coexisting on the same carbon skeleton. Naming these polyfunctional compounds requires you to combine every rule you have learned into a systematic, step-by-step process.

The Complete Naming Algorithm

Here is the full process, from start to finish, for naming any organic molecule:

Step 1: Identify every functional group in the molecule. Scan the entire structure and list every functional group you see: -OH, -COOH, -NH2, -CHO, C=O, C=C, halogens, ethers, etc.

Step 2: Determine the principal functional group. Use the priority table from Section 1.10. The highest-priority group in the molecule gets the suffix. Everything else becomes a prefix.

Step 3: Identify the parent chain. Find the longest carbon chain that includes the principal functional group. This chain determines the root name.

Step 4: Number the parent chain. Start numbering from the end that gives the principal functional group the lowest locant. If there is a tie, give the lower locant to the double/triple bond. If there is still a tie, use the lowest set of locants for substituents.

Step 5: Name and number every substituent. Convert each non-principal functional group into its prefix form. Assign a locant to each.

Step 6: Assemble the name. List all prefixes alphabetically, followed by the parent chain root and suffix. Separate numbers from letters with hyphens. Separate numbers from numbers with commas.

Worked Example 1: An Amino Acid

Let’s name 2-aminopropanoic acid (the amino acid alanine).

Structure: CH3-CH(NH2)-COOH

Step 1: Functional groups present: carboxylic acid (-COOH) and amine (-NH2).

Step 2: Carboxylic acid (priority 1) beats amine (priority 7). Suffix = “-oic acid.”

Step 3: Longest chain through the -COOH: three carbons = propan-.

Step 4: Number from the -COOH end. The carboxyl carbon is C1 (always terminal for -oic acid).

Step 5: The amine at C2 becomes the prefix “2-amino.”

Step 6: Assemble: 2-aminopropanoic acid.

This is exactly how all amino acids are named systematically. The common name is alanine, but the IUPAC name tells you the structure: three carbons (prop-), a carboxylic acid (-oic acid) at C1, and an amine (amino-) at C2.

Worked Example 2: A Keto Acid

Let’s name 3-oxobutanoic acid (acetoacetic acid, a ketone body).

Structure: CH3-CO-CH2-COOH

Step 1: Functional groups: carboxylic acid (-COOH) and ketone (C=O in the chain interior).

Step 2: Carboxylic acid beats ketone. Suffix = “-oic acid.”

Step 3: Longest chain through the -COOH: four carbons = butan-.

Step 4: Carboxyl carbon = C1.

Step 5: The internal ketone at C3 becomes the prefix “3-oxo.”

Step 6: Assemble: 3-oxobutanoic acid.

Worked Example 3: Unsaturation Plus a Functional Group

Let’s name (E)-4-hydroxyhex-2-enoic acid.

Structure: A six-carbon chain with a carboxylic acid at C1, a trans double bond between C2 and C3, and a hydroxyl at C4.

Step 1: Functional groups: carboxylic acid, double bond, alcohol.

Step 2: Carboxylic acid is the highest priority. Suffix = “-oic acid.”

Step 3: Longest chain through -COOH and the double bond: six carbons = hex-.

Step 4: -COOH at C1. Double bond at C2 (hex-2-en-). -OH at C4.

Step 5: The alcohol becomes “4-hydroxy.” The double bond is indicated as “-2-en-” in the parent name. The E/Z designation (E)- goes at the beginning.

Step 6: Assemble: (E)-4-hydroxyhex-2-enoic acid.

Worked Example 4: A Halogenated Compound

Let’s name 5-bromo-3-methylpentan-2-one.

Structure: A five-carbon chain with a ketone at C2, a methyl branch at C3, and a bromine at C5.

Step 1: Functional groups: ketone, halide (Br), alkyl substituent (methyl).

Step 2: Ketone is the highest-priority suffix-eligible group. Suffix = “-one.”

Step 3: Five carbons = pentan-.

Step 4: Ketone at C2 = pentan-2-one.

Step 5: Methyl at C3 = “3-methyl.” Bromine at C5 = “5-bromo.”

Step 6: Alphabetical order: bromo before methyl. Assemble: 5-bromo-3-methylpentan-2-one.

Naming Compounds with Multiple Identical Functional Groups

When a molecule has two or more of the same functional group (e.g., two -OH groups), use multiplying prefixes:

  • Two hydroxyl groups: “-diol” (e.g., propane-1,2-diol)
  • Three hydroxyl groups: “-triol” (e.g., propane-1,2,3-triol = glycerol)
  • Two carboxylic acids: “-dioic acid” (e.g., butanedioic acid = succinic acid)
  • Two double bonds: “-diene” (e.g., buta-1,3-diene)
  • Two amino groups: “diamino-” (e.g., 1,6-diaminohexane)

The Reverse Skill: Name to Structure

As we discussed in Section 1.1, the MCAT tests “reverse nomenclature” - reading a name and building the structure. Let’s practice this with a complex example.

Name: (Z)-2-amino-4-methylhex-4-enoic acid

Decode:

  1. “-oic acid” = carboxylic acid at C1
  2. “hex-” = six-carbon parent chain
  3. “4-en-” = double bond starting at C4
  4. “(Z)-” = higher-priority groups on same side of the double bond
  5. “2-amino” = -NH2 at C2
  6. “4-methyl” = -CH3 branch at C4

Build the structure:

  • Draw six carbons in a chain
  • Place -COOH at C1
  • Place -NH2 at C2
  • Place C=C between C4 and C5
  • Place -CH3 at C4 (same carbon where the double bond starts)
  • Arrange groups around the double bond so higher-priority groups are on the same side (Z)

This compound looks like an unusual amino acid - and indeed, many non-standard amino acids have exactly this kind of structure. The ability to build a structure from a name is the core skill the MCAT is testing.

Common MCAT Traps in Polyfunctional Naming

Trap 1: Confusing “oxo-” with “-one.” If the suffix is already taken (e.g., by -oic acid), a ketone becomes the prefix “oxo-,” not the suffix “-one.” Students who see an MCAT answer choice listing “3-oxopentanoic acid” sometimes don’t recognize that “oxo” means there is a ketone at C3.

Trap 2: Forgetting that double bonds change the parent chain ending. The parent chain is “hexan-” (no double bond) vs. “hex-2-en-” (double bond at C2). That “an” to “en” change is easy to miss in a long name.

Trap 3: Thinking all amino acids use the -amine suffix. In amino acids, the amine is never the principal group because the carboxylic acid always outranks it. The amine appears as the prefix “amino-.” The compound is named as an acid, not an amine.

Trap 4: Misordering prefixes. Prefixes must be in alphabetical order, ignoring di-, tri-, tetra-. “amino-” comes before “bromo-” which comes before “methyl-.” Scrambled prefix order is a common wrong-answer distractor.

Final Practice: Decode This Name

Name: methyl (E)-4-aminopent-2-enoate

Decode:

  1. “-oate” at the end = ester
  2. “methyl” at the beginning = the alkyl group on the oxygen side of the ester (from methanol)
  3. “pent-” = five-carbon acyl chain
  4. “2-en-” = double bond at C2
  5. “(E)-” = higher-priority groups on opposite sides
  6. “4-amino” = -NH2 at C4

This is a methyl ester of a five-carbon unsaturated amino acid. The structure: CH3-OOC-CH=CH-CH(NH2)-CH3 with (E) geometry at the double bond.

A molecule has a -COOH at one end, an -NH2 at C2, and an -OH at C4 on a five-carbon chain. What is its IUPAC name?
Click to reveal answer
2-amino-4-hydroxypentanoic acid. Carboxylic acid is the highest-priority group (suffix = "-oic acid"). The amine becomes the prefix "2-amino" and the alcohol becomes "4-hydroxy." The parent chain is five carbons = pentanoic acid. Alphabetical order: amino before hydroxy.
In the name "3-oxopentanoic acid," what functional group does "oxo-" represent, and why doesn't it get the suffix "-one"?
Click to reveal answer
"Oxo-" represents a ketone (carbonyl) at C3. It does not get the suffix "-one" because a higher-priority group (carboxylic acid, "-oic acid") has already claimed the suffix. When a ketone or aldehyde is outranked, it becomes the prefix "oxo-." The suffix always goes to the highest-priority functional group.
What is the first step when you encounter a complex IUPAC name on the MCAT and need to draw the structure?
Click to reveal answer
Start with the suffix. The suffix tells you the principal functional group and where it sits (usually C1 for -oic acid and -al; a specific locant for -ol and -one). Then read the root to determine the parent chain length. Finally, add prefixes from right to left, placing each at its numbered position. Suffix first, root second, prefixes last.